C16H18N2O4S — CID 57163246
(6-carbamimidoylnaphthalen-2-yl)methylsulfonyl butanoate (PubChem CID 57163246) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl)methylsulfonyl butanoate.
| Compound Name | (6-carbamimidoylnaphthalen-2-yl)methylsulfonyl butanoate |
|---|---|
| PubChem CID | 57163246 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl)methylsulfonyl butanoate |
| SMILES | [H]/N=C(\N)c1ccc2cc(CS(=O)(=O)OC(=O)CCC)ccc2c1 |
| InChI | InChI=1S/C16H18N2O4S/c1-2-3-15(19)22-23(20,21)10-11-4-5-13-9-14(16(17)18)7-6-12(13)8-11/h4-9H,2-3,10H2,1H3,(H3,17,18) |
| InChIKey | ACEGDPKFVLUARA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|