C25H28N2O3 — CID 10644932
tert-butyl 2-[4-[2-(6-carbamimidoylnaphthalen-2-yl)ethyl]phenoxy]acetate (PubChem CID 10644932) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-(6-carbamimidoylnaphthalen-2-yl)ethyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[2-(6-carbamimidoylnaphthalen-2-yl)ethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 10644932 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | tert-butyl 2-[4-[2-(6-carbamimidoylnaphthalen-2-yl)ethyl]phenoxy]acetate |
| SMILES | [H]/N=C(\N)c1ccc2cc(CCc3ccc(OCC(=O)OC(C)(C)C)cc3)ccc2c1 |
| InChI | InChI=1S/C25H28N2O3/c1-25(2,3)30-23(28)16-29-22-12-7-17(8-13-22)4-5-18-6-9-20-15-21(24(26)27)11-10-19(20)14-18/h6-15H,4-5,16H2,1-3H3,(H3,26,27) |
| InChIKey | BYFOSDKYIJXRLA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|