C22H23N3O5 — CID 67721890
tert-butyl 2-[4-[(6-carbamimidoyl-2-benzofuran-1-carbonyl)amino]phenoxy]acetate (PubChem CID 67721890) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is tert-butyl 2-[4-[(6-carbamimidoyl-2-benzofuran-1-carbonyl)amino]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[(6-carbamimidoyl-2-benzofuran-1-carbonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 67721890 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | tert-butyl 2-[4-[(6-carbamimidoyl-2-benzofuran-1-carbonyl)amino]phenoxy]acetate |
| SMILES | [H]/N=C(\N)c1ccc2coc(C(=O)Nc3ccc(OCC(=O)OC(C)(C)C)cc3)c2c1 |
| InChI | InChI=1S/C22H23N3O5/c1-22(2,3)30-18(26)12-28-16-8-6-15(7-9-16)25-21(27)19-17-10-13(20(23)24)4-5-14(17)11-29-19/h4-11H,12H2,1-3H3,(H3,23,24)(H,25,27) |
| InChIKey | WVGHYOZISPIVMD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|