C20H16N2O5 — CID 67673656
ethyl 2-[4-[(5-cyano-2-benzofuran-1-carbonyl)amino]phenoxy]acetate (PubChem CID 67673656) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is ethyl 2-[4-[(5-cyano-2-benzofuran-1-carbonyl)amino]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(5-cyano-2-benzofuran-1-carbonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 67673656 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | ethyl 2-[4-[(5-cyano-2-benzofuran-1-carbonyl)amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(NC(=O)c2occ3cc(C#N)ccc23)cc1 |
| InChI | InChI=1S/C20H16N2O5/c1-2-25-18(23)12-26-16-6-4-15(5-7-16)22-20(24)19-17-8-3-13(10-21)9-14(17)11-27-19/h3-9,11H,2,12H2,1H3,(H,22,24) |
| InChIKey | YDXOOPUBTBSPHB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |