C20H22N2O5 — CID 57257960
[1-(3-ethoxy-3-oxopropyl)piperidin-4-yl] 5-cyano-2-benzofuran-1-carboxylate (PubChem CID 57257960) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is [1-(3-ethoxy-3-oxopropyl)piperidin-4-yl] 5-cyano-2-benzofuran-1-carboxylate.
| Compound Name | [1-(3-ethoxy-3-oxopropyl)piperidin-4-yl] 5-cyano-2-benzofuran-1-carboxylate |
|---|---|
| PubChem CID | 57257960 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [1-(3-ethoxy-3-oxopropyl)piperidin-4-yl] 5-cyano-2-benzofuran-1-carboxylate |
| SMILES | CCOC(=O)CCN1CCC(OC(=O)c2occ3cc(C#N)ccc23)CC1 |
| InChI | InChI=1S/C20H22N2O5/c1-2-25-18(23)7-10-22-8-5-16(6-9-22)27-20(24)19-17-4-3-14(12-21)11-15(17)13-26-19/h3-4,11,13,16H,2,5-10H2,1H3 |
| InChIKey | NGXJXHUNRBQLOZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |