C12H12Cl3NO4 — CID 2725562
ethyl 2-[4-[(2,2,2-trichloroacetyl)amino]phenoxy]acetate (PubChem CID 2725562) has the molecular formula C12H12Cl3NO4 and a molecular weight of 340.59 g/mol. Its IUPAC name is ethyl 2-[4-[(2,2,2-trichloroacetyl)amino]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(2,2,2-trichloroacetyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 2725562 |
| Molecular Formula | C12H12Cl3NO4 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | ethyl 2-[4-[(2,2,2-trichloroacetyl)amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(NC(=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C12H12Cl3NO4/c1-2-19-10(17)7-20-9-5-3-8(4-6-9)16-11(18)12(13,14)15/h3-6H,2,7H2,1H3,(H,16,18) |
| InChIKey | IQQFJBCENUSLAH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|