C17H14N4O5 — CID 10360756
2-[4-[(5-carbamimidoylfuro[2,3-b]pyridine-2-carbonyl)amino]phenoxy]acetic acid (PubChem CID 10360756) has the molecular formula C17H14N4O5 and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-[4-[(5-carbamimidoylfuro[2,3-b]pyridine-2-carbonyl)amino]phenoxy]acetic acid.
| Compound Name | 2-[4-[(5-carbamimidoylfuro[2,3-b]pyridine-2-carbonyl)amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10360756 |
| Molecular Formula | C17H14N4O5 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[4-[(5-carbamimidoylfuro[2,3-b]pyridine-2-carbonyl)amino]phenoxy]acetic acid |
| SMILES | [H]/N=C(\N)c1cnc2oc(C(=O)Nc3ccc(OCC(=O)O)cc3)cc2c1 |
| InChI | InChI=1S/C17H14N4O5/c18-15(19)10-5-9-6-13(26-17(9)20-7-10)16(24)21-11-1-3-12(4-2-11)25-8-14(22)23/h1-7H,8H2,(H3,18,19)(H,21,24)(H,22,23) |
| InChIKey | ILWBNXKXGHHFHQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|