C19H17N3O5 — CID 10090365
2-[4-[(5-carbamimidoyl-3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]acetic acid (PubChem CID 10090365) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-[4-[(5-carbamimidoyl-3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]acetic acid.
| Compound Name | 2-[4-[(5-carbamimidoyl-3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10090365 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[4-[(5-carbamimidoyl-3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc2oc(C(=O)Nc3ccc(OCC(=O)O)cc3)c(C)c2c1 |
| InChI | InChI=1S/C19H17N3O5/c1-10-14-8-11(18(20)21)2-7-15(14)27-17(10)19(25)22-12-3-5-13(6-4-12)26-9-16(23)24/h2-8H,9H2,1H3,(H3,20,21)(H,22,25)(H,23,24) |
| InChIKey | LXYJIVQTTACVBR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|