C19H17NO3 — CID 7464080
N-(4-acetylphenyl)-3,5-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 7464080) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(4-acetylphenyl)-3,5-dimethyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-acetylphenyl)-3,5-dimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7464080 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-(4-acetylphenyl)-3,5-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2oc3ccc(C)cc3c2C)cc1 |
| InChI | InChI=1S/C19H17NO3/c1-11-4-9-17-16(10-11)12(2)18(23-17)19(22)20-15-7-5-14(6-8-15)13(3)21/h4-10H,1-3H3,(H,20,22) |
| InChIKey | JIESOKBLTXAMNI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |