C20H20N2O3 — CID 27104970
N-(4-acetamidophenyl)-3,5,7-trimethyl-1-benzofuran-2-carboxamide (PubChem CID 27104970) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-3,5,7-trimethyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-3,5,7-trimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 27104970 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-(4-acetamidophenyl)-3,5,7-trimethyl-1-benzofuran-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2oc3c(C)cc(C)cc3c2C)cc1 |
| InChI | InChI=1S/C20H20N2O3/c1-11-9-12(2)18-17(10-11)13(3)19(25-18)20(24)22-16-7-5-15(6-8-16)21-14(4)23/h5-10H,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | BXKWNQXNUDAPSE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |