C23H24N2O5S — CID 10670773
tert-butyl 2-[4-[(5-carbamothioyl-3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]acetate (PubChem CID 10670773) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is tert-butyl 2-[4-[(5-carbamothioyl-3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[(5-carbamothioyl-3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 10670773 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | tert-butyl 2-[4-[(5-carbamothioyl-3-methyl-1-benzofuran-2-carbonyl)amino]phenoxy]acetate |
| SMILES | Cc1c(C(=O)Nc2ccc(OCC(=O)OC(C)(C)C)cc2)oc2ccc(C(N)=S)cc12 |
| InChI | InChI=1S/C23H24N2O5S/c1-13-17-11-14(21(24)31)5-10-18(17)29-20(13)22(27)25-15-6-8-16(9-7-15)28-12-19(26)30-23(2,3)4/h5-11H,12H2,1-4H3,(H2,24,31)(H,25,27) |
| InChIKey | WTBDOBYRLPFROF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|