C12H10N2O4S — CID 114030968
2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid (PubChem CID 114030968) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid.
| Compound Name | 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid |
|---|---|
| PubChem CID | 114030968 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(NC(=O)c2cncs2)cc1 |
| InChI | InChI=1S/C12H10N2O4S/c15-11(16)6-18-9-3-1-8(2-4-9)14-12(17)10-5-13-7-19-10/h1-5,7H,6H2,(H,14,17)(H,15,16) |
| InChIKey | OZRUYIVDBDZXBN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |