2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid

C12H10N2O4S — CID 114030968

IUPAC2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid
SMILESO=C(O)COc1ccc(NC(=O)c2cncs2)cc1
InChIInChI=1S/C12H10N2O4S/c15-11(16)6-18-9-3-1-8(2-4-9)14-12(17)10-5-13-7-19-10/h1-5,7H,6H2,(H,14,17)(H,15,16)
InChIKeyOZRUYIVDBDZXBN-UHFFFAOYSA-N
MW278.29 g/mol
LogP1.86
Rot. Bonds5

About 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid

2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid (PubChem CID 114030968) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid
PubChem CID114030968
Molecular FormulaC12H10N2O4S
Molecular Weight278.29 g/mol
Exact Mass278.04
IUPAC Name2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid
SMILESO=C(O)COc1ccc(NC(=O)c2cncs2)cc1
InChIInChI=1S/C12H10N2O4S/c15-11(16)6-18-9-3-1-8(2-4-9)14-12(17)10-5-13-7-19-10/h1-5,7H,6H2,(H,14,17)(H,15,16)
InChIKeyOZRUYIVDBDZXBN-UHFFFAOYSA-N
XLogP1.86
TPSA88.52 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.29
LogP ≤ 51.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid?
The IUPAC name of 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid (CID 114030968) is 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid.
What is the SMILES notation for 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid?
The canonical SMILES for 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid is O=C(O)COc1ccc(NC(=O)c2cncs2)cc1.
What is the InChIKey of 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid?
The InChIKey is OZRUYIVDBDZXBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O4S/c15-11(16)6-18-9-3-1-8(2-4-9)14-12(17)10-5-13-7-19-10/h1-5,7H,6H2,(H,14,17)(H,15,16).
What are the key properties of 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid?
2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid has a molecular weight of 278.29 g/mol, XLogP of 1.86, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-thiazole-5-carbonylamino)phenoxy]acetic acid is sourced from PubChem (CID 114030968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).