C9H6BrN3OS — CID 103789386
N-(6-bromo-3-pyridinyl)-1,3-thiazole-5-carboxamide (PubChem CID 103789386) has the molecular formula C9H6BrN3OS and a molecular weight of 284.14 g/mol. Its IUPAC name is N-(6-bromo-3-pyridinyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(6-bromo-3-pyridinyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 103789386 |
| Molecular Formula | C9H6BrN3OS |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 282.94 |
| IUPAC Name | N-(6-bromo-3-pyridinyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Br)nc1)c1cncs1 |
| InChI | InChI=1S/C9H6BrN3OS/c10-8-2-1-6(3-12-8)13-9(14)7-4-11-5-15-7/h1-5H,(H,13,14) |
| InChIKey | UJBATUUVBTYKSX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|