C12H10N2O5 — CID 63745197
2-[4-(1,2-oxazole-3-carbonylamino)phenoxy]acetic acid (PubChem CID 63745197) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 2-[4-(1,2-oxazole-3-carbonylamino)phenoxy]acetic acid.
| Compound Name | 2-[4-(1,2-oxazole-3-carbonylamino)phenoxy]acetic acid |
|---|---|
| PubChem CID | 63745197 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-[4-(1,2-oxazole-3-carbonylamino)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(NC(=O)c2ccon2)cc1 |
| InChI | InChI=1S/C12H10N2O5/c15-11(16)7-18-9-3-1-8(2-4-9)13-12(17)10-5-6-19-14-10/h1-6H,7H2,(H,13,17)(H,15,16) |
| InChIKey | CNQLCMTXEXUPRB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |