C22H26N4O5 — CID 23370049
tert-butyl 2-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]-3-methylphenoxy]acetate (PubChem CID 23370049) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is tert-butyl 2-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]-3-methylphenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]-3-methylphenoxy]acetate |
|---|---|
| PubChem CID | 23370049 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | tert-butyl 2-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]-3-methylphenoxy]acetate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NC(=O)Nc2ccc(OCC(=O)OC(C)(C)C)cc2C)cc1 |
| InChI | InChI=1S/C22H26N4O5/c1-13-11-16(30-12-18(27)31-22(2,3)4)9-10-17(13)25-21(29)26-20(28)15-7-5-14(6-8-15)19(23)24/h5-11H,12H2,1-4H3,(H3,23,24)(H2,25,26,28,29) |
| InChIKey | WFJPSWVPRCCAEZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|