C23H25N3O4S — CID 10765524
tert-butyl 2-[4-[[6-(C-methylsulfanylcarbonimidoyl)-1H-indole-2-carbonyl]amino]phenoxy]acetate (PubChem CID 10765524) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is tert-butyl 2-[4-[[6-(C-methylsulfanylcarbonimidoyl)-1H-indole-2-carbonyl]amino]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[[6-(C-methylsulfanylcarbonimidoyl)-1H-indole-2-carbonyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 10765524 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | tert-butyl 2-[4-[[6-(C-methylsulfanylcarbonimidoyl)-1H-indole-2-carbonyl]amino]phenoxy]acetate |
| SMILES | [H]/N=C(\SC)c1ccc2cc(C(=O)Nc3ccc(OCC(=O)OC(C)(C)C)cc3)[nH]c2c1 |
| InChI | InChI=1S/C23H25N3O4S/c1-23(2,3)30-20(27)13-29-17-9-7-16(8-10-17)25-22(28)19-11-14-5-6-15(21(24)31-4)12-18(14)26-19/h5-12,24,26H,13H2,1-4H3,(H,25,28)/b24-21- |
| InChIKey | XSTBUTRZWIRCEO-FLFQWRMESA-N |
| XLogP | 4.83 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|