C25H29N3O6S — CID 18646529
4-O-tert-butyl 1-O-methyl (2S)-2-[[3-[[4-(C-methylsulfanylcarbonimidoyl)benzoyl]amino]benzoyl]amino]butanedioate (PubChem CID 18646529) has the molecular formula C25H29N3O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-[[4-(C-methylsulfanylcarbonimidoyl)benzoyl]amino]benzoyl]amino]butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-[[4-(C-methylsulfanylcarbonimidoyl)benzoyl]amino]benzoyl]amino]butanedioate |
|---|---|
| PubChem CID | 18646529 |
| Molecular Formula | C25H29N3O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl (2S)-2-[[3-[[4-(C-methylsulfanylcarbonimidoyl)benzoyl]amino]benzoyl]amino]butanedioate |
| SMILES | [H]/N=C(\SC)c1ccc(C(=O)Nc2cccc(C(=O)N[C@@H](CC(=O)OC(C)(C)C)C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C25H29N3O6S/c1-25(2,3)34-20(29)14-19(24(32)33-4)28-23(31)17-7-6-8-18(13-17)27-22(30)16-11-9-15(10-12-16)21(26)35-5/h6-13,19,26H,14H2,1-5H3,(H,27,30)(H,28,31)/b26-21-/t19-/m0/s1 |
| InChIKey | BHLXIYPONGFQEZ-KOAPHTDDSA-N |
| XLogP | 3.63 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|