C21H30N4O3S — CID 10645718
tert-butyl 7-[[6-(C-methylsulfanylcarbonimidoyl)-1H-indazole-3-carbonyl]amino]heptanoate (PubChem CID 10645718) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is tert-butyl 7-[[6-(C-methylsulfanylcarbonimidoyl)-1H-indazole-3-carbonyl]amino]heptanoate.
| Compound Name | tert-butyl 7-[[6-(C-methylsulfanylcarbonimidoyl)-1H-indazole-3-carbonyl]amino]heptanoate |
|---|---|
| PubChem CID | 10645718 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | tert-butyl 7-[[6-(C-methylsulfanylcarbonimidoyl)-1H-indazole-3-carbonyl]amino]heptanoate |
| SMILES | [H]/N=C(\SC)c1ccc2c(C(=O)NCCCCCCC(=O)OC(C)(C)C)n[nH]c2c1 |
| InChI | InChI=1S/C21H30N4O3S/c1-21(2,3)28-17(26)9-7-5-6-8-12-23-20(27)18-15-11-10-14(19(22)29-4)13-16(15)24-25-18/h10-11,13,22H,5-9,12H2,1-4H3,(H,23,27)(H,24,25)/b22-19- |
| InChIKey | NKDZBHCVZKAIIL-QOCHGBHMSA-N |
| XLogP | 4.27 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|