C23H25F2NO4 — CID 158619679
tert-butyl 5-fluoro-4-[[4-[(4-fluorophenyl)carbamoyl]phenoxy]methyl]pent-4-enoate (PubChem CID 158619679) has the molecular formula C23H25F2NO4 and a molecular weight of 417.45 g/mol. Its IUPAC name is tert-butyl 5-fluoro-4-[[4-[(4-fluorophenyl)carbamoyl]phenoxy]methyl]pent-4-enoate.
| Compound Name | tert-butyl 5-fluoro-4-[[4-[(4-fluorophenyl)carbamoyl]phenoxy]methyl]pent-4-enoate |
|---|---|
| PubChem CID | 158619679 |
| Molecular Formula | C23H25F2NO4 |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | tert-butyl 5-fluoro-4-[[4-[(4-fluorophenyl)carbamoyl]phenoxy]methyl]pent-4-enoate |
| SMILES | CC(C)(C)OC(=O)CCC(=CF)COc1ccc(C(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H25F2NO4/c1-23(2,3)30-21(27)13-4-16(14-24)15-29-20-11-5-17(6-12-20)22(28)26-19-9-7-18(25)8-10-19/h5-12,14H,4,13,15H2,1-3H3,(H,26,28) |
| InChIKey | GUXBBMRWDMTRBW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |