C15H22FN2O2+ — CID 148846324
[2-[[4-(tert-butylcarbamoyl)phenoxy]methyl]-3-fluoroprop-2-enyl]azanium (PubChem CID 148846324) has the molecular formula C15H22FN2O2+ and a molecular weight of 281.35 g/mol. Its IUPAC name is [2-[[4-(tert-butylcarbamoyl)phenoxy]methyl]-3-fluoroprop-2-enyl]azanium.
| Compound Name | [2-[[4-(tert-butylcarbamoyl)phenoxy]methyl]-3-fluoroprop-2-enyl]azanium |
|---|---|
| PubChem CID | 148846324 |
| Molecular Formula | C15H22FN2O2+ |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | [2-[[4-(tert-butylcarbamoyl)phenoxy]methyl]-3-fluoroprop-2-enyl]azanium |
| SMILES | CC(C)(C)NC(=O)c1ccc(OCC(=CF)C[NH3+])cc1 |
| InChI | InChI=1S/C15H21FN2O2/c1-15(2,3)18-14(19)12-4-6-13(7-5-12)20-10-11(8-16)9-17/h4-8H,9-10,17H2,1-3H3,(H,18,19)/p+1 |
| InChIKey | OWNSXNXYELKDSO-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |