C15H21FN2O2 — CID 159419183
N-tert-butyl-5-[(2E)-2-(fluoromethylidene)butoxy]pyridine-2-carboxamide (PubChem CID 159419183) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is N-tert-butyl-5-[(2E)-2-(fluoromethylidene)butoxy]pyridine-2-carboxamide.
| Compound Name | N-tert-butyl-5-[(2E)-2-(fluoromethylidene)butoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 159419183 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-tert-butyl-5-[(2E)-2-(fluoromethylidene)butoxy]pyridine-2-carboxamide |
| SMILES | CC/C(=C\F)COc1ccc(C(=O)NC(C)(C)C)nc1 |
| InChI | InChI=1S/C15H21FN2O2/c1-5-11(8-16)10-20-12-6-7-13(17-9-12)14(19)18-15(2,3)4/h6-9H,5,10H2,1-4H3,(H,18,19)/b11-8+ |
| InChIKey | WROBQFOPIKDCCI-DHZHZOJOSA-N |
| XLogP | 3.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |