C20H29FN2O4 — CID 159327454
tert-butyl (E)-4-[[6-(diethylcarbamoyl)-3-pyridinyl]oxymethyl]-5-fluoropent-4-enoate (PubChem CID 159327454) has the molecular formula C20H29FN2O4 and a molecular weight of 380.46 g/mol. Its IUPAC name is tert-butyl (E)-4-[[6-(diethylcarbamoyl)-3-pyridinyl]oxymethyl]-5-fluoropent-4-enoate.
| Compound Name | tert-butyl (E)-4-[[6-(diethylcarbamoyl)-3-pyridinyl]oxymethyl]-5-fluoropent-4-enoate |
|---|---|
| PubChem CID | 159327454 |
| Molecular Formula | C20H29FN2O4 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | tert-butyl (E)-4-[[6-(diethylcarbamoyl)-3-pyridinyl]oxymethyl]-5-fluoropent-4-enoate |
| SMILES | CCN(CC)C(=O)c1ccc(OC/C(=C/F)CCC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C20H29FN2O4/c1-6-23(7-2)19(25)17-10-9-16(13-22-17)26-14-15(12-21)8-11-18(24)27-20(3,4)5/h9-10,12-13H,6-8,11,14H2,1-5H3/b15-12+ |
| InChIKey | NNWRXTIJVBDEPQ-NTCAYCPXSA-N |
| XLogP | 3.92 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |