C14H12Br2N2O4 — CID 122207546
methyl 2-[4-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]phenoxy]acetate (PubChem CID 122207546) has the molecular formula C14H12Br2N2O4 and a molecular weight of 432.07 g/mol. Its IUPAC name is methyl 2-[4-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 122207546 |
| Molecular Formula | C14H12Br2N2O4 |
| Molecular Weight | 432.07 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | methyl 2-[4-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)c2cc(Br)c(Br)[nH]2)cc1 |
| InChI | InChI=1S/C14H12Br2N2O4/c1-21-12(19)7-22-9-4-2-8(3-5-9)17-14(20)11-6-10(15)13(16)18-11/h2-6,18H,7H2,1H3,(H,17,20) |
| InChIKey | PXGXRZWUEJQLOG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.07 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |