C19H19Br2N3O6 — CID 162661246
diethyl 2-[[4-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]benzoyl]amino]propanedioate (PubChem CID 162661246) has the molecular formula C19H19Br2N3O6 and a molecular weight of 545.18 g/mol. Its IUPAC name is diethyl 2-[[4-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]benzoyl]amino]propanedioate.
| Compound Name | diethyl 2-[[4-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]benzoyl]amino]propanedioate |
|---|---|
| PubChem CID | 162661246 |
| Molecular Formula | C19H19Br2N3O6 |
| Molecular Weight | 545.18 g/mol |
| Exact Mass | 542.96 |
| IUPAC Name | diethyl 2-[[4-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]benzoyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1ccc(NC(=O)c2cc(Br)c(Br)[nH]2)cc1)C(=O)OCC |
| InChI | InChI=1S/C19H19Br2N3O6/c1-3-29-18(27)14(19(28)30-4-2)24-16(25)10-5-7-11(8-6-10)22-17(26)13-9-12(20)15(21)23-13/h5-9,14,23H,3-4H2,1-2H3,(H,22,26)(H,24,25) |
| InChIKey | DDMQZZBMECJGRD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|