C22H30N2O4S — CID 88694163
(6-carbamimidoylnaphthalen-2-yl)methylsulfonyl decanoate (PubChem CID 88694163) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl)methylsulfonyl decanoate.
| Compound Name | (6-carbamimidoylnaphthalen-2-yl)methylsulfonyl decanoate |
|---|---|
| PubChem CID | 88694163 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl)methylsulfonyl decanoate |
| SMILES | [H]/N=C(\N)c1ccc2cc(CS(=O)(=O)OC(=O)CCCCCCCCC)ccc2c1 |
| InChI | InChI=1S/C22H30N2O4S/c1-2-3-4-5-6-7-8-9-21(25)28-29(26,27)16-17-10-11-19-15-20(22(23)24)13-12-18(19)14-17/h10-15H,2-9,16H2,1H3,(H3,23,24) |
| InChIKey | BLEMHKHVEIRKEQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|