C24H29Cl2N3O3S — CID 70104374
ethyl 3-(6-carbamimidoyl-1-benzothiophen-2-yl)-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoate;dihydrochloride (PubChem CID 70104374) has the molecular formula C24H29Cl2N3O3S and a molecular weight of 510.49 g/mol. Its IUPAC name is ethyl 3-(6-carbamimidoyl-1-benzothiophen-2-yl)-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoate;dihydrochloride.
| Compound Name | ethyl 3-(6-carbamimidoyl-1-benzothiophen-2-yl)-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoate;dihydrochloride |
|---|---|
| PubChem CID | 70104374 |
| Molecular Formula | C24H29Cl2N3O3S |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | ethyl 3-(6-carbamimidoyl-1-benzothiophen-2-yl)-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2cc(CC(C(=O)OCC)c3ccc(O[C@H]4CCNC4)cc3)sc2c1 |
| InChI | InChI=1S/C24H27N3O3S.2ClH/c1-2-29-24(28)21(15-5-7-18(8-6-15)30-19-9-10-27-14-19)13-20-11-16-3-4-17(23(25)26)12-22(16)31-20;;/h3-8,11-12,19,21,27H,2,9-10,13-14H2,1H3,(H3,25,26);2*1H/t19-,21?;;/m0../s1 |
| InChIKey | DVISNIXPOFDCMD-DAUSETMNSA-N |
| XLogP | 4.66 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|