C22H25Cl2N3O4 — CID 70072969
2-(5-carbamimidoyl-1-benzofuran-2-yl)-3-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid;dihydrochloride (PubChem CID 70072969) has the molecular formula C22H25Cl2N3O4 and a molecular weight of 466.37 g/mol. Its IUPAC name is 2-(5-carbamimidoyl-1-benzofuran-2-yl)-3-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid;dihydrochloride.
| Compound Name | 2-(5-carbamimidoyl-1-benzofuran-2-yl)-3-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 70072969 |
| Molecular Formula | C22H25Cl2N3O4 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-(5-carbamimidoyl-1-benzofuran-2-yl)-3-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2oc(C(Cc3ccc(O[C@H]4CCNC4)cc3)C(=O)O)cc2c1 |
| InChI | InChI=1S/C22H23N3O4.2ClH/c23-21(24)14-3-6-19-15(10-14)11-20(29-19)18(22(26)27)9-13-1-4-16(5-2-13)28-17-7-8-25-12-17;;/h1-6,10-11,17-18,25H,7-9,12H2,(H3,23,24)(H,26,27);2*1H/t17-,18?;;/m0../s1 |
| InChIKey | NPGMHSYPWZMFSH-SEFHDJSNSA-N |
| XLogP | 3.71 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|