C22H23N3O4 — CID 67593638
3-[3-(5-carbamimidoyl-1-benzofuran-2-yl)-4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid (PubChem CID 67593638) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-[3-(5-carbamimidoyl-1-benzofuran-2-yl)-4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid.
| Compound Name | 3-[3-(5-carbamimidoyl-1-benzofuran-2-yl)-4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 67593638 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-[3-(5-carbamimidoyl-1-benzofuran-2-yl)-4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc2oc(-c3cc(CCC(=O)O)ccc3O[C@H]3CCNC3)cc2c1 |
| InChI | InChI=1S/C22H23N3O4/c23-22(24)14-3-5-18-15(10-14)11-20(29-18)17-9-13(2-6-21(26)27)1-4-19(17)28-16-7-8-25-12-16/h1,3-5,9-11,16,25H,2,6-8,12H2,(H3,23,24)(H,26,27)/t16-/m0/s1 |
| InChIKey | BYIWSUFYQRBBQW-INIZCTEOSA-N |
| XLogP | 3.14 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|