C22H24N4O3 — CID 57213857
3-(5-carbamimidoyl-1H-indol-2-yl)-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid (PubChem CID 57213857) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-(5-carbamimidoyl-1H-indol-2-yl)-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid.
| Compound Name | 3-(5-carbamimidoyl-1H-indol-2-yl)-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 57213857 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-(5-carbamimidoyl-1H-indol-2-yl)-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc2[nH]c(CC(C(=O)O)c3ccc(O[C@H]4CCNC4)cc3)cc2c1 |
| InChI | InChI=1S/C22H24N4O3/c23-21(24)14-3-6-20-15(9-14)10-16(26-20)11-19(22(27)28)13-1-4-17(5-2-13)29-18-7-8-25-12-18/h1-6,9-10,18-19,25-26H,7-8,11-12H2,(H3,23,24)(H,27,28)/t18-,19?/m0/s1 |
| InChIKey | DOKZZOAQNHJBRU-OYKVQYDMSA-N |
| XLogP | 2.60 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|