C31H29N3O4 — CID 139911493
(2S)-3-[7-(N-benzoylcarbamimidoyl)naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid (PubChem CID 139911493) has the molecular formula C31H29N3O4 and a molecular weight of 507.59 g/mol. Its IUPAC name is (2S)-3-[7-(N-benzoylcarbamimidoyl)naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid.
| Compound Name | (2S)-3-[7-(N-benzoylcarbamimidoyl)naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 139911493 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (2S)-3-[7-(N-benzoylcarbamimidoyl)naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid |
| SMILES | [H]/N=C(\NC(=O)c1ccccc1)c1ccc2ccc(C[C@H](C(=O)O)c3ccc(O[C@H]4CCNC4)cc3)cc2c1 |
| InChI | InChI=1S/C31H29N3O4/c32-29(34-30(35)23-4-2-1-3-5-23)24-9-8-21-7-6-20(16-25(21)18-24)17-28(31(36)37)22-10-12-26(13-11-22)38-27-14-15-33-19-27/h1-13,16,18,27-28,33H,14-15,17,19H2,(H,36,37)(H2,32,34,35)/t27-,28-/m0/s1 |
| InChIKey | WCQXOJBOAFYCLO-NSOVKSMOSA-N |
| XLogP | 4.75 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|