C24H30Cl2N4O3 — CID 70075776
3-(6-carbamimidoyl-1-ethylindol-2-yl)-2-[4-[(3R)-pyrrolidin-3-yl]oxyphenyl]propanoic acid;dihydrochloride (PubChem CID 70075776) has the molecular formula C24H30Cl2N4O3 and a molecular weight of 493.44 g/mol. Its IUPAC name is 3-(6-carbamimidoyl-1-ethylindol-2-yl)-2-[4-[(3R)-pyrrolidin-3-yl]oxyphenyl]propanoic acid;dihydrochloride.
| Compound Name | 3-(6-carbamimidoyl-1-ethylindol-2-yl)-2-[4-[(3R)-pyrrolidin-3-yl]oxyphenyl]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 70075776 |
| Molecular Formula | C24H30Cl2N4O3 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 3-(6-carbamimidoyl-1-ethylindol-2-yl)-2-[4-[(3R)-pyrrolidin-3-yl]oxyphenyl]propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2cc(CC(C(=O)O)c3ccc(O[C@@H]4CCNC4)cc3)n(CC)c2c1 |
| InChI | InChI=1S/C24H28N4O3.2ClH/c1-2-28-18(11-16-3-4-17(23(25)26)12-22(16)28)13-21(24(29)30)15-5-7-19(8-6-15)31-20-9-10-27-14-20;;/h3-8,11-12,20-21,27H,2,9-10,13-14H2,1H3,(H3,25,26)(H,29,30);2*1H/t20-,21?;;/m1../s1 |
| InChIKey | LYBHQLNSEZNQCH-MNXZOPJNSA-N |
| XLogP | 3.94 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|