C27H30N4O3 — CID 139614556
3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-[(3R)-1-ethanimidoylpiperidin-3-yl]oxyphenyl]propanoic acid (PubChem CID 139614556) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-[(3R)-1-ethanimidoylpiperidin-3-yl]oxyphenyl]propanoic acid.
| Compound Name | 3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-[(3R)-1-ethanimidoylpiperidin-3-yl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 139614556 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 3-(7-carbamimidoylnaphthalen-2-yl)-2-[4-[(3R)-1-ethanimidoylpiperidin-3-yl]oxyphenyl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CC(C(=O)O)c3ccc(O[C@@H]4CCCN(/C(C)=N/[H])C4)cc3)cc2c1 |
| InChI | InChI=1S/C27H30N4O3/c1-17(28)31-12-2-3-24(16-31)34-23-10-8-20(9-11-23)25(27(32)33)14-18-4-5-19-6-7-21(26(29)30)15-22(19)13-18/h4-11,13,15,24-25,28H,2-3,12,14,16H2,1H3,(H3,29,30)(H,32,33)/b28-17+/t24-,25?/m1/s1 |
| InChIKey | HESPGYURENPLDI-BXGZEWCNSA-N |
| XLogP | 4.38 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|