C27H32N6O2 — CID 15392363
1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-1-[4-(1-ethanimidoylpyrrolidin-3-yl)oxyphenyl]-3-ethylurea (PubChem CID 15392363) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-1-[4-(1-ethanimidoylpyrrolidin-3-yl)oxyphenyl]-3-ethylurea.
| Compound Name | 1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-1-[4-(1-ethanimidoylpyrrolidin-3-yl)oxyphenyl]-3-ethylurea |
|---|---|
| PubChem CID | 15392363 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-1-[4-(1-ethanimidoylpyrrolidin-3-yl)oxyphenyl]-3-ethylurea |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CN(C(=O)NCC)c3ccc(OC4CCN(/C(C)=N/[H])C4)cc3)cc2c1 |
| InChI | InChI=1S/C27H32N6O2/c1-3-31-27(34)33(16-19-4-5-20-6-7-21(26(29)30)15-22(20)14-19)23-8-10-24(11-9-23)35-25-12-13-32(17-25)18(2)28/h4-11,14-15,25,28H,3,12-13,16-17H2,1-2H3,(H3,29,30)(H,31,34)/b28-18+ |
| InChIKey | DKGPAAJBVGBTTA-MTDXEUNCSA-N |
| XLogP | 4.31 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|