C24H25N3O4 — CID 142676427
(2S)-3-[7-amino-1-(hydroxyiminomethyl)naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid (PubChem CID 142676427) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is (2S)-3-[7-amino-1-(hydroxyiminomethyl)naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid.
| Compound Name | (2S)-3-[7-amino-1-(hydroxyiminomethyl)naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 142676427 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (2S)-3-[7-amino-1-(hydroxyiminomethyl)naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid |
| SMILES | Nc1ccc2ccc(C[C@H](C(=O)O)c3ccc(O[C@H]4CCNC4)cc3)c(C=NO)c2c1 |
| InChI | InChI=1S/C24H25N3O4/c25-18-6-3-15-1-2-17(23(14-27-30)21(15)12-18)11-22(24(28)29)16-4-7-19(8-5-16)31-20-9-10-26-13-20/h1-8,12,14,20,22,26,30H,9-11,13,25H2,(H,28,29)/t20-,22-/m0/s1 |
| InChIKey | FHUZUAYSJSRNTL-UNMCSNQZSA-N |
| XLogP | 3.38 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|