C26H30ClN3O4 — CID 139911484
ethyl (2S)-3-[7-[(hydroxyhydrazinylidene)methyl]naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoate;hydrochloride (PubChem CID 139911484) has the molecular formula C26H30ClN3O4 and a molecular weight of 484.00 g/mol. Its IUPAC name is ethyl (2S)-3-[7-[(hydroxyhydrazinylidene)methyl]naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoate;hydrochloride.
| Compound Name | ethyl (2S)-3-[7-[(hydroxyhydrazinylidene)methyl]naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 139911484 |
| Molecular Formula | C26H30ClN3O4 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | ethyl (2S)-3-[7-[(hydroxyhydrazinylidene)methyl]naphthalen-2-yl]-2-[4-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoate;hydrochloride |
| SMILES | CCOC(=O)[C@@H](Cc1ccc2ccc(C=NNO)cc2c1)c1ccc(O[C@H]2CCNC2)cc1.Cl |
| InChI | InChI=1S/C26H29N3O4.ClH/c1-2-32-26(30)25(21-7-9-23(10-8-21)33-24-11-12-27-17-24)15-18-3-5-20-6-4-19(16-28-29-31)14-22(20)13-18;/h3-10,13-14,16,24-25,27,29,31H,2,11-12,15,17H2,1H3;1H/t24-,25-;/m0./s1 |
| InChIKey | DNIZETMZFNCDSW-DKIIUIKKSA-N |
| XLogP | 4.20 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|