C26H31N3O4S — CID 56974382
3-[2-[2-(5-carbamimidoyl-1-benzothiophen-2-yl)ethyl]-4-ethoxy-5-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid (PubChem CID 56974382) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is 3-[2-[2-(5-carbamimidoyl-1-benzothiophen-2-yl)ethyl]-4-ethoxy-5-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid.
| Compound Name | 3-[2-[2-(5-carbamimidoyl-1-benzothiophen-2-yl)ethyl]-4-ethoxy-5-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 56974382 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 3-[2-[2-(5-carbamimidoyl-1-benzothiophen-2-yl)ethyl]-4-ethoxy-5-[(3S)-pyrrolidin-3-yl]oxyphenyl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc2sc(CCc3cc(OCC)c(O[C@H]4CCNC4)cc3CCC(=O)O)cc2c1 |
| InChI | InChI=1S/C26H31N3O4S/c1-2-32-22-13-16(3-6-21-12-19-11-18(26(27)28)4-7-24(19)34-21)17(5-8-25(30)31)14-23(22)33-20-9-10-29-15-20/h4,7,11-14,20,29H,2-3,5-6,8-10,15H2,1H3,(H3,27,28)(H,30,31)/t20-/m0/s1 |
| InChIKey | PBYNDOCGDYXDAW-FQEVSTJZSA-N |
| XLogP | 4.13 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|