C25H30Cl2N4O3S — CID 67593294
[4-[(1-ethanimidoylpyrrolidin-3-yl)methoxy]phenyl] 3-(5-carbamimidoyl-1-benzothiophen-2-yl)propanoate;dihydrochloride (PubChem CID 67593294) has the molecular formula C25H30Cl2N4O3S and a molecular weight of 537.51 g/mol. Its IUPAC name is [4-[(1-ethanimidoylpyrrolidin-3-yl)methoxy]phenyl] 3-(5-carbamimidoyl-1-benzothiophen-2-yl)propanoate;dihydrochloride.
| Compound Name | [4-[(1-ethanimidoylpyrrolidin-3-yl)methoxy]phenyl] 3-(5-carbamimidoyl-1-benzothiophen-2-yl)propanoate;dihydrochloride |
|---|---|
| PubChem CID | 67593294 |
| Molecular Formula | C25H30Cl2N4O3S |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | [4-[(1-ethanimidoylpyrrolidin-3-yl)methoxy]phenyl] 3-(5-carbamimidoyl-1-benzothiophen-2-yl)propanoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2sc(CCC(=O)Oc3ccc(OCC4CCN(/C(C)=N/[H])C4)cc3)cc2c1 |
| InChI | InChI=1S/C25H28N4O3S.2ClH/c1-16(26)29-11-10-17(14-29)15-31-20-3-5-21(6-4-20)32-24(30)9-7-22-13-19-12-18(25(27)28)2-8-23(19)33-22;;/h2-6,8,12-13,17,26H,7,9-11,14-15H2,1H3,(H3,27,28);2*1H/b26-16+;; |
| InChIKey | KPQCIOHEWAESGA-SZQCDHDFSA-N |
| XLogP | 5.27 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|