C25H31N5O5 — CID 15486827
methyl 4-carbamimidoyl-2-[2-[[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]amino]ethoxy]benzoate (PubChem CID 15486827) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is methyl 4-carbamimidoyl-2-[2-[[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]amino]ethoxy]benzoate.
| Compound Name | methyl 4-carbamimidoyl-2-[2-[[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]amino]ethoxy]benzoate |
|---|---|
| PubChem CID | 15486827 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | methyl 4-carbamimidoyl-2-[2-[[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]amino]ethoxy]benzoate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)OC)c(OCCNC(=O)c2ccc(OC3CCN(/C(C)=N/[H])CC3)cc2)c1 |
| InChI | InChI=1S/C25H31N5O5/c1-16(26)30-12-9-20(10-13-30)35-19-6-3-17(4-7-19)24(31)29-11-14-34-22-15-18(23(27)28)5-8-21(22)25(32)33-2/h3-8,15,20,26H,9-14H2,1-2H3,(H3,27,28)(H,29,31)/b26-16+ |
| InChIKey | WRIXYQOEVBJSPN-WGOQTCKBSA-N |
| XLogP | 2.41 |
| TPSA | 150.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|