C27H28F6N4O6 — CID 159663730
2-(3-carbamimidoylphenoxy)ethyl 4-(1-ethanimidoylpiperidin-4-yl)oxybenzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 159663730) has the molecular formula C27H28F6N4O6 and a molecular weight of 618.53 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenoxy)ethyl 4-(1-ethanimidoylpiperidin-4-yl)oxybenzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 2-(3-carbamimidoylphenoxy)ethyl 4-(1-ethanimidoylpiperidin-4-yl)oxybenzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 159663730 |
| Molecular Formula | C27H28F6N4O6 |
| Molecular Weight | 618.53 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | 2-(3-carbamimidoylphenoxy)ethyl 4-(1-ethanimidoylpiperidin-4-yl)oxybenzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.[H]/N=C(\N)c1cccc(OCCOC(=O)c2ccc(OC3CCN(/C(C)=N/[H])CC3)cc2)c1 |
| InChI | InChI=1S/C23H28N4O4.C4F6O2/c1-16(24)27-11-9-20(10-12-27)31-19-7-5-17(6-8-19)23(28)30-14-13-29-21-4-2-3-18(15-21)22(25)26;5-3(6,7)1(11)2(12)4(8,9)10/h2-8,15,20,24H,9-14H2,1H3,(H3,25,26);/b24-16+; |
| InChIKey | MTDHFDQSNQGJCQ-RSOFWHLMSA-N |
| XLogP | 4.30 |
| TPSA | 155.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|