C24H22F6N4O5 — CID 158436066
2-(3-carbamimidoylphenoxy)ethyl 4-(1-methyl-4,5-dihydroimidazol-2-yl)benzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 158436066) has the molecular formula C24H22F6N4O5 and a molecular weight of 560.45 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenoxy)ethyl 4-(1-methyl-4,5-dihydroimidazol-2-yl)benzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 2-(3-carbamimidoylphenoxy)ethyl 4-(1-methyl-4,5-dihydroimidazol-2-yl)benzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 158436066 |
| Molecular Formula | C24H22F6N4O5 |
| Molecular Weight | 560.45 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 2-(3-carbamimidoylphenoxy)ethyl 4-(1-methyl-4,5-dihydroimidazol-2-yl)benzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.[H]/N=C(\N)c1cccc(OCCOC(=O)c2ccc(C3=NCCN3C)cc2)c1 |
| InChI | InChI=1S/C20H22N4O3.C4F6O2/c1-24-10-9-23-19(24)14-5-7-15(8-6-14)20(25)27-12-11-26-17-4-2-3-16(13-17)18(21)22;5-3(6,7)1(11)2(12)4(8,9)10/h2-8,13H,9-12H2,1H3,(H3,21,22); |
| InChIKey | HCFUWYGXCCSCJS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|