C30H31F6N5O7 — CID 157169783
[4-carbamimidoyl-2-[2-[4-(pyrrolidine-1-carboximidoyl)benzoyl]oxyethoxy]phenyl] pyrrolidine-1-carboxylate;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 157169783) has the molecular formula C30H31F6N5O7 and a molecular weight of 687.59 g/mol. Its IUPAC name is [4-carbamimidoyl-2-[2-[4-(pyrrolidine-1-carboximidoyl)benzoyl]oxyethoxy]phenyl] pyrrolidine-1-carboxylate;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | [4-carbamimidoyl-2-[2-[4-(pyrrolidine-1-carboximidoyl)benzoyl]oxyethoxy]phenyl] pyrrolidine-1-carboxylate;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 157169783 |
| Molecular Formula | C30H31F6N5O7 |
| Molecular Weight | 687.59 g/mol |
| Exact Mass | 687.21 |
| IUPAC Name | [4-carbamimidoyl-2-[2-[4-(pyrrolidine-1-carboximidoyl)benzoyl]oxyethoxy]phenyl] pyrrolidine-1-carboxylate;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)N2CCCC2)c(OCCOC(=O)c2ccc(/C(=N/[H])N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C26H31N5O5.C4F6O2/c27-23(28)20-9-10-21(36-26(33)31-13-3-4-14-31)22(17-20)34-15-16-35-25(32)19-7-5-18(6-8-19)24(29)30-11-1-2-12-30;5-3(6,7)1(11)2(12)4(8,9)10/h5-10,17,29H,1-4,11-16H2,(H3,27,28);/b29-24-; |
| InChIKey | ANIFNVAONNGKJY-PSVMXRHTSA-N |
| XLogP | 4.47 |
| TPSA | 176.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|