C25H32FN5O2 — CID 89388083
[2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl] (2S,3S)-2-(3-carbamimidoyl-N-methylanilino)-3-methylpentanoate (PubChem CID 89388083) has the molecular formula C25H32FN5O2 and a molecular weight of 453.56 g/mol. Its IUPAC name is [2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl] (2S,3S)-2-(3-carbamimidoyl-N-methylanilino)-3-methylpentanoate.
| Compound Name | [2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl] (2S,3S)-2-(3-carbamimidoyl-N-methylanilino)-3-methylpentanoate |
|---|---|
| PubChem CID | 89388083 |
| Molecular Formula | C25H32FN5O2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | [2-fluoro-4-(pyrrolidine-1-carboximidoyl)phenyl] (2S,3S)-2-(3-carbamimidoyl-N-methylanilino)-3-methylpentanoate |
| SMILES | [H]/N=C(\N)c1cccc(N(C)[C@H](C(=O)Oc2ccc(/C(=N/[H])N3CCCC3)cc2F)[C@@H](C)CC)c1 |
| InChI | InChI=1S/C25H32FN5O2/c1-4-16(2)22(30(3)19-9-7-8-17(14-19)23(27)28)25(32)33-21-11-10-18(15-20(21)26)24(29)31-12-5-6-13-31/h7-11,14-16,22,29H,4-6,12-13H2,1-3H3,(H3,27,28)/b29-24-/t16-,22-/m0/s1 |
| InChIKey | SLYDOBCVBQSVRD-ZCTSPFHYSA-N |
| XLogP | 3.99 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|