C23H27N5O3 — CID 89394506
[4-(pyrrolidine-1-carboximidoyl)phenyl] (2S,4R)-1-(3-carbamimidoylphenyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 89394506) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is [4-(pyrrolidine-1-carboximidoyl)phenyl] (2S,4R)-1-(3-carbamimidoylphenyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | [4-(pyrrolidine-1-carboximidoyl)phenyl] (2S,4R)-1-(3-carbamimidoylphenyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 89394506 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | [4-(pyrrolidine-1-carboximidoyl)phenyl] (2S,4R)-1-(3-carbamimidoylphenyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1cccc(N2C[C@H](O)C[C@H]2C(=O)Oc2ccc(/C(=N/[H])N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C23H27N5O3/c24-21(25)16-4-3-5-17(12-16)28-14-18(29)13-20(28)23(30)31-19-8-6-15(7-9-19)22(26)27-10-1-2-11-27/h3-9,12,18,20,26,29H,1-2,10-11,13-14H2,(H3,24,25)/b26-22-/t18-,20+/m1/s1 |
| InChIKey | GPBCVMMJDGKGLI-HKTKLAJTSA-N |
| XLogP | 1.94 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|