C13H17N3O2 — CID 86675973
(2S)-1-(3-carbamimidoylphenyl)piperidine-2-carboxylic acid (PubChem CID 86675973) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (2S)-1-(3-carbamimidoylphenyl)piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-(3-carbamimidoylphenyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 86675973 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (2S)-1-(3-carbamimidoylphenyl)piperidine-2-carboxylic acid |
| SMILES | [H]/N=C(\N)c1cccc(N2CCCC[C@H]2C(=O)O)c1 |
| InChI | InChI=1S/C13H17N3O2/c14-12(15)9-4-3-5-10(8-9)16-7-2-1-6-11(16)13(17)18/h3-5,8,11H,1-2,6-7H2,(H3,14,15)(H,17,18)/t11-/m0/s1 |
| InChIKey | IWYVIWRSWKSCJF-NSHDSACASA-N |
| XLogP | 1.41 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|