C29H32F6N4O6 — CID 157429100
2-[5-carbamimidoyl-2-(2-methylpropoxy)phenoxy]ethyl 4-(pyrrolidine-1-carboximidoyl)benzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 157429100) has the molecular formula C29H32F6N4O6 and a molecular weight of 646.59 g/mol. Its IUPAC name is 2-[5-carbamimidoyl-2-(2-methylpropoxy)phenoxy]ethyl 4-(pyrrolidine-1-carboximidoyl)benzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 2-[5-carbamimidoyl-2-(2-methylpropoxy)phenoxy]ethyl 4-(pyrrolidine-1-carboximidoyl)benzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 157429100 |
| Molecular Formula | C29H32F6N4O6 |
| Molecular Weight | 646.59 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | 2-[5-carbamimidoyl-2-(2-methylpropoxy)phenoxy]ethyl 4-(pyrrolidine-1-carboximidoyl)benzoate;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.[H]/N=C(\N)c1ccc(OCC(C)C)c(OCCOC(=O)c2ccc(/C(=N/[H])N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C25H32N4O4.C4F6O2/c1-17(2)16-33-21-10-9-20(23(26)27)15-22(21)31-13-14-32-25(30)19-7-5-18(6-8-19)24(28)29-11-3-4-12-29;5-3(6,7)1(11)2(12)4(8,9)10/h5-10,15,17,28H,3-4,11-14,16H2,1-2H3,(H3,26,27);/b28-24-; |
| InChIKey | BQHWDEHVSSWZEL-QQBZCDAESA-N |
| XLogP | 4.91 |
| TPSA | 155.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|