C13H17F3N2O3 — CID 115468146
4-[2-(2-methoxyethoxy)ethoxy]-3-(trifluoromethyl)benzenecarboximidamide (PubChem CID 115468146) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 4-[2-(2-methoxyethoxy)ethoxy]-3-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-[2-(2-methoxyethoxy)ethoxy]-3-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 115468146 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-[2-(2-methoxyethoxy)ethoxy]-3-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCOCCOC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O3/c1-19-4-5-20-6-7-21-11-3-2-9(12(17)18)8-10(11)13(14,15)16/h2-3,8H,4-7H2,1H3,(H3,17,18) |
| InChIKey | IUMLGDBFARVZCC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|