C22H25F3N4O4 — CID 59506134
N-(4-carbamimidoylphenyl)-N'-[1-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide (PubChem CID 59506134) has the molecular formula C22H25F3N4O4 and a molecular weight of 466.46 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[1-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[1-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide |
|---|---|
| PubChem CID | 59506134 |
| Molecular Formula | C22H25F3N4O4 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[1-[4-(2-methoxyethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CC(=O)NC(C)c2ccc(OCCOC)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H25F3N4O4/c1-13(15-5-8-18(33-10-9-32-2)17(11-15)22(23,24)25)28-19(30)12-20(31)29-16-6-3-14(4-7-16)21(26)27/h3-8,11,13H,9-10,12H2,1-2H3,(H3,26,27)(H,28,30)(H,29,31) |
| InChIKey | ROZLYXVXNRBJPA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|