C21H23F3N4O4 — CID 59506151
N-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-(2-hydroxyethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide (PubChem CID 59506151) has the molecular formula C21H23F3N4O4 and a molecular weight of 452.43 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-(2-hydroxyethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-(2-hydroxyethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide |
|---|---|
| PubChem CID | 59506151 |
| Molecular Formula | C21H23F3N4O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-(2-hydroxyethoxy)-3-(trifluoromethyl)phenyl]ethyl]propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CC(=O)N[C@@H](C)c2ccc(OCCO)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H23F3N4O4/c1-12(14-4-7-17(32-9-8-29)16(10-14)21(22,23)24)27-18(30)11-19(31)28-15-5-2-13(3-6-15)20(25)26/h2-7,10,12,29H,8-9,11H2,1H3,(H3,25,26)(H,27,30)(H,28,31)/t12-/m0/s1 |
| InChIKey | AXQACINYAJOLCF-LBPRGKRZSA-N |
| XLogP | 2.57 |
| TPSA | 137.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|