C24H22F3N5O4S — CID 59506153
N-(4-carbamimidoylphenyl)-N'-[1-[4-pyridin-4-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide (PubChem CID 59506153) has the molecular formula C24H22F3N5O4S and a molecular weight of 533.53 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[1-[4-pyridin-4-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[1-[4-pyridin-4-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide |
|---|---|
| PubChem CID | 59506153 |
| Molecular Formula | C24H22F3N5O4S |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[1-[4-pyridin-4-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CC(=O)NC(C)c2ccc(S(=O)(=O)c3ccncc3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H22F3N5O4S/c1-14(31-21(33)13-22(34)32-17-5-2-15(3-6-17)23(28)29)16-4-7-20(19(12-16)24(25,26)27)37(35,36)18-8-10-30-11-9-18/h2-12,14H,13H2,1H3,(H3,28,29)(H,31,33)(H,32,34) |
| InChIKey | OKQVHNYNZRCSPO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|