C23H27F3N6O4S — CID 59506236
N-(4-carbamimidoylphenyl)-N'-[1-[4-piperazin-1-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide (PubChem CID 59506236) has the molecular formula C23H27F3N6O4S and a molecular weight of 540.57 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[1-[4-piperazin-1-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[1-[4-piperazin-1-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide |
|---|---|
| PubChem CID | 59506236 |
| Molecular Formula | C23H27F3N6O4S |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[1-[4-piperazin-1-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CC(=O)NC(C)c2ccc(S(=O)(=O)N3CCNCC3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H27F3N6O4S/c1-14(30-20(33)13-21(34)31-17-5-2-15(3-6-17)22(27)28)16-4-7-19(18(12-16)23(24,25)26)37(35,36)32-10-8-29-9-11-32/h2-7,12,14,29H,8-11,13H2,1H3,(H3,27,28)(H,30,33)(H,31,34) |
| InChIKey | ICWVGSMUTITJKZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 157.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|